C9H12Br2O4 — CID 175446474
2,2-bis(2-bromoethyl)-3-methylidenebutanedioic acid (PubChem CID 175446474) has the molecular formula C9H12Br2O4 and a molecular weight of 344.00 g/mol. Its IUPAC name is 2,2-bis(2-bromoethyl)-3-methylidenebutanedioic acid.
| Compound Name | 2,2-bis(2-bromoethyl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 175446474 |
| Molecular Formula | C9H12Br2O4 |
| Molecular Weight | 344.00 g/mol |
| Exact Mass | 341.91 |
| IUPAC Name | 2,2-bis(2-bromoethyl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CCBr)(CCBr)C(=O)O |
| InChI | InChI=1S/C9H12Br2O4/c1-6(7(12)13)9(2-4-10,3-5-11)8(14)15/h1-5H2,(H,12,13)(H,14,15) |
| InChIKey | QIVZHMCKHRLVIO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.00 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|