C16H22O8 — CID 87354014
2,2-bis[2-(2-methylprop-2-enoyloxy)ethyl]butanedioic acid (PubChem CID 87354014) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 2,2-bis[2-(2-methylprop-2-enoyloxy)ethyl]butanedioic acid.
| Compound Name | 2,2-bis[2-(2-methylprop-2-enoyloxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 87354014 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2,2-bis[2-(2-methylprop-2-enoyloxy)ethyl]butanedioic acid |
| SMILES | C=C(C)C(=O)OCCC(CCOC(=O)C(=C)C)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22O8/c1-10(2)13(19)23-7-5-16(15(21)22,9-12(17)18)6-8-24-14(20)11(3)4/h1,3,5-9H2,2,4H3,(H,17,18)(H,21,22) |
| InChIKey | KXVMYGHPBBVSFN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|