C21H32O10-2 — CID 22289309
2,2-bis[2-(2-butoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate (PubChem CID 22289309) has the molecular formula C21H32O10-2 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2,2-bis[2-(2-butoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate.
| Compound Name | 2,2-bis[2-(2-butoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 22289309 |
| Molecular Formula | C21H32O10-2 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2,2-bis[2-(2-butoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)OCCOCCCC)(CC(=O)OCCOCCCC)C(=O)[O-] |
| InChI | InChI=1S/C21H34O10/c1-4-6-8-28-10-12-30-17(22)14-21(20(26)27,16(3)19(24)25)15-18(23)31-13-11-29-9-7-5-2/h3-15H2,1-2H3,(H,24,25)(H,26,27)/p-2 |
| InChIKey | DVAJSJSTMJXHPH-UHFFFAOYSA-L |
| XLogP | -0.47 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|