C25H26O8 — CID 22288974
3-methylidene-2,2-bis[2-oxo-2-(1-phenylethoxy)ethyl]butanedioic acid (PubChem CID 22288974) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-methylidene-2,2-bis[2-oxo-2-(1-phenylethoxy)ethyl]butanedioic acid.
| Compound Name | 3-methylidene-2,2-bis[2-oxo-2-(1-phenylethoxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 22288974 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-methylidene-2,2-bis[2-oxo-2-(1-phenylethoxy)ethyl]butanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OC(C)c1ccccc1)(CC(=O)OC(C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H26O8/c1-16(23(28)29)25(24(30)31,14-21(26)32-17(2)19-10-6-4-7-11-19)15-22(27)33-18(3)20-12-8-5-9-13-20/h4-13,17-18H,1,14-15H2,2-3H3,(H,28,29)(H,30,31) |
| InChIKey | GUPAVZIRYIRBOD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|