About 1-phenylethyl 3-anilinopropanoate
1-phenylethyl 3-anilinopropanoate (PubChem CID 61277472) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-phenylethyl 3-anilinopropanoate.
Molecular Properties
| Compound Name | 1-phenylethyl 3-anilinopropanoate |
| PubChem CID | 61277472 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-phenylethyl 3-anilinopropanoate |
| SMILES | CC(OC(=O)CCNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-14(15-8-4-2-5-9-15)20-17(19)12-13-18-16-10-6-3-7-11-16/h2-11,14,18H,12-13H2,1H3 |
| InChIKey | INKMACDOWCLKCK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylethyl 3-anilinopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 3-anilinopropanoate?
The IUPAC name of 1-phenylethyl 3-anilinopropanoate (CID 61277472) is 1-phenylethyl 3-anilinopropanoate.
What is the SMILES notation for 1-phenylethyl 3-anilinopropanoate?
The canonical SMILES for 1-phenylethyl 3-anilinopropanoate is CC(OC(=O)CCNc1ccccc1)c1ccccc1.
What is the InChIKey of 1-phenylethyl 3-anilinopropanoate?
The InChIKey is INKMACDOWCLKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-14(15-8-4-2-5-9-15)20-17(19)12-13-18-16-10-6-3-7-11-16/h2-11,14,18H,12-13H2,1H3.
What are the key properties of 1-phenylethyl 3-anilinopropanoate?
1-phenylethyl 3-anilinopropanoate has a molecular weight of 269.34 g/mol, XLogP of 3.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 3-anilinopropanoate is sourced from PubChem (CID 61277472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).