About methane;1-phenylethyl butanoate
methane;1-phenylethyl butanoate (PubChem CID 175131064) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is methane;1-phenylethyl butanoate.
Molecular Properties
| Compound Name | methane;1-phenylethyl butanoate |
| PubChem CID | 175131064 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | methane;1-phenylethyl butanoate |
| SMILES | C.CCCC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C12H16O2.CH4/c1-3-7-12(13)14-10(2)11-8-5-4-6-9-11;/h4-6,8-10H,3,7H2,1-2H3;1H4 |
| InChIKey | PWIVPMGCLVRVSK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;1-phenylethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-phenylethyl butanoate?
The IUPAC name of methane;1-phenylethyl butanoate (CID 175131064) is methane;1-phenylethyl butanoate.
What is the SMILES notation for methane;1-phenylethyl butanoate?
The canonical SMILES for methane;1-phenylethyl butanoate is C.CCCC(=O)OC(C)c1ccccc1.
What is the InChIKey of methane;1-phenylethyl butanoate?
The InChIKey is PWIVPMGCLVRVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2.CH4/c1-3-7-12(13)14-10(2)11-8-5-4-6-9-11;/h4-6,8-10H,3,7H2,1-2H3;1H4.
What are the key properties of methane;1-phenylethyl butanoate?
methane;1-phenylethyl butanoate has a molecular weight of 208.30 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-phenylethyl butanoate is sourced from PubChem (CID 175131064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).