C104H204O8Sn — CID 141476577
tris[[4-ethyl-2,2-bis(2-ethylhexyl)octanoyl]oxy]stannyl 4-ethyl-2,2-bis(2-ethylhexyl)octanoate (PubChem CID 141476577) has the molecular formula C104H204O8Sn and a molecular weight of 1701.48 g/mol. Its IUPAC name is tris[[4-ethyl-2,2-bis(2-ethylhexyl)octanoyl]oxy]stannyl 4-ethyl-2,2-bis(2-ethylhexyl)octanoate.
| Compound Name | tris[[4-ethyl-2,2-bis(2-ethylhexyl)octanoyl]oxy]stannyl 4-ethyl-2,2-bis(2-ethylhexyl)octanoate |
|---|---|
| PubChem CID | 141476577 |
| Molecular Formula | C104H204O8Sn |
| Molecular Weight | 1701.48 g/mol |
| Exact Mass | 1701.46 |
| IUPAC Name | tris[[4-ethyl-2,2-bis(2-ethylhexyl)octanoyl]oxy]stannyl 4-ethyl-2,2-bis(2-ethylhexyl)octanoate |
| SMILES | CCCCC(CC)CC(CC(CC)CCCC)(CC(CC)CCCC)C(=O)O[Sn](OC(=O)C(CC(CC)CCCC)(CC(CC)CCCC)CC(CC)CCCC)(OC(=O)C(CC(CC)CCCC)(CC(CC)CCCC)CC(CC)CCCC)OC(=O)C(CC(CC)CCCC)(CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/4C26H52O2.Sn/c4*1-7-13-16-22(10-4)19-26(25(27)28,20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3;/h4*22-24H,7-21H2,1-6H3,(H,27,28);/q;;;;+4/p-4 |
| InChIKey | DXXHKKCQKXUNIK-UHFFFAOYSA-J |
| XLogP | 34.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 80 |
| Heavy Atoms | 113 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1701.48 |
| LogP ≤ 5 | 34.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |