C26H48Na2O4 — CID 129218641
disodium;2,2-bis(2-ethylhexyl)decanedioate (PubChem CID 129218641) has the molecular formula C26H48Na2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is disodium;2,2-bis(2-ethylhexyl)decanedioate.
| Compound Name | disodium;2,2-bis(2-ethylhexyl)decanedioate |
|---|---|
| PubChem CID | 129218641 |
| Molecular Formula | C26H48Na2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | disodium;2,2-bis(2-ethylhexyl)decanedioate |
| SMILES | CCCCC(CC)CC(CCCCCCCC(=O)[O-])(CC(CC)CCCC)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C26H50O4.2Na/c1-5-9-16-22(7-3)20-26(25(29)30,21-23(8-4)17-10-6-2)19-15-13-11-12-14-18-24(27)28;;/h22-23H,5-21H2,1-4H3,(H,27,28)(H,29,30);;/q;2*+1/p-2 |
| InChIKey | XYLAJACWWIETSL-UHFFFAOYSA-L |
| XLogP | -0.58 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|