About gold(1+);octadecanoate
gold(1+);octadecanoate (PubChem CID 23509280) has the molecular formula C18H35AuO2
and a molecular weight of 480.44 g/mol. Its IUPAC name is gold(1+);octadecanoate.
Molecular Properties
| Compound Name | gold(1+);octadecanoate |
| PubChem CID | 23509280 |
| Molecular Formula | C18H35AuO2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | gold(1+);octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[Au+] |
| InChI | InChI=1S/C18H36O2.Au/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+1/p-1 |
| InChIKey | NMFDLALBIQJQDX-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);octadecanoate?
The IUPAC name of gold(1+);octadecanoate (CID 23509280) is gold(1+);octadecanoate.
What is the SMILES notation for gold(1+);octadecanoate?
The canonical SMILES for gold(1+);octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].[Au+].
What is the InChIKey of gold(1+);octadecanoate?
The InChIKey is NMFDLALBIQJQDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.Au/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+1/p-1.
What are the key properties of gold(1+);octadecanoate?
gold(1+);octadecanoate has a molecular weight of 480.44 g/mol, XLogP of 5.00, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);octadecanoate is sourced from PubChem (CID 23509280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).