C15H24O4-2 — CID 23174463
2,2-bis(2,2-dimethylpropyl)-3-methylidenebutanedioate (PubChem CID 23174463) has the molecular formula C15H24O4-2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2,2-bis(2,2-dimethylpropyl)-3-methylidenebutanedioate.
| Compound Name | 2,2-bis(2,2-dimethylpropyl)-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 23174463 |
| Molecular Formula | C15H24O4-2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2,2-bis(2,2-dimethylpropyl)-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(C)(C)C)(CC(C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C15H26O4/c1-10(11(16)17)15(12(18)19,8-13(2,3)4)9-14(5,6)7/h1,8-9H2,2-7H3,(H,16,17)(H,18,19)/p-2 |
| InChIKey | WINSQANVVHALMK-UHFFFAOYSA-L |
| XLogP | 0.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|