C14H22FeO4 — CID 175333497
bis(3,3-dimethyl-2-methylidenebutanoate);iron(2+) (PubChem CID 175333497) has the molecular formula C14H22FeO4 and a molecular weight of 310.17 g/mol. Its IUPAC name is bis(3,3-dimethyl-2-methylidenebutanoate);iron(2+).
| Compound Name | bis(3,3-dimethyl-2-methylidenebutanoate);iron(2+) |
|---|---|
| PubChem CID | 175333497 |
| Molecular Formula | C14H22FeO4 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | bis(3,3-dimethyl-2-methylidenebutanoate);iron(2+) |
| SMILES | C=C(C(=O)[O-])C(C)(C)C.C=C(C(=O)[O-])C(C)(C)C.[Fe+2] |
| InChI | InChI=1S/2C7H12O2.Fe/c2*1-5(6(8)9)7(2,3)4;/h2*1H2,2-4H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | UFYMMEKGFIBDQI-UHFFFAOYSA-L |
| XLogP | 0.67 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|