C5H6K2O4 — CID 87067111
dipotassium;2,2-dimethylpropanedioate (PubChem CID 87067111) has the molecular formula C5H6K2O4 and a molecular weight of 208.29 g/mol. Its IUPAC name is dipotassium;2,2-dimethylpropanedioate.
| Compound Name | dipotassium;2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 87067111 |
| Molecular Formula | C5H6K2O4 |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 207.95 |
| IUPAC Name | dipotassium;2,2-dimethylpropanedioate |
| SMILES | CC(C)(C(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C5H8O4.2K/c1-5(2,3(6)7)4(8)9;;/h1-2H3,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| InChIKey | MVTYPWLHUYZVBS-UHFFFAOYSA-L |
| XLogP | -8.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | -8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|