C6H7NaO5 — CID 142301985
sodium 4-hydroxy-2,2-dimethyl-3,4-dioxobutanoate (PubChem CID 142301985) has the molecular formula C6H7NaO5 and a molecular weight of 182.11 g/mol. Its IUPAC name is sodium 4-hydroxy-2,2-dimethyl-3,4-dioxobutanoate.
| Compound Name | sodium 4-hydroxy-2,2-dimethyl-3,4-dioxobutanoate |
|---|---|
| PubChem CID | 142301985 |
| Molecular Formula | C6H7NaO5 |
| Molecular Weight | 182.11 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | sodium 4-hydroxy-2,2-dimethyl-3,4-dioxobutanoate |
| SMILES | CC(C)(C(=O)[O-])C(=O)C(=O)O.[Na+] |
| InChI | InChI=1S/C6H8O5.Na/c1-6(2,5(10)11)3(7)4(8)9;/h1-2H3,(H,8,9)(H,10,11);/q;+1/p-1 |
| InChIKey | XSBJSVLHNFYNPX-UHFFFAOYSA-M |
| XLogP | -4.58 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.11 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|