C5H6CuO4 — CID 88802618
copper 2,2-dimethylpropanedioate (PubChem CID 88802618) has the molecular formula C5H6CuO4 and a molecular weight of 193.64 g/mol. Its IUPAC name is copper 2,2-dimethylpropanedioate.
| Compound Name | copper 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 88802618 |
| Molecular Formula | C5H6CuO4 |
| Molecular Weight | 193.64 g/mol |
| Exact Mass | 192.96 |
| IUPAC Name | copper 2,2-dimethylpropanedioate |
| SMILES | CC(C)(C(=O)[O-])C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/C5H8O4.Cu/c1-5(2,3(6)7)4(8)9;/h1-2H3,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChIKey | HACQKLDMWSFTIP-UHFFFAOYSA-L |
| XLogP | -2.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.64 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|