About 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium
3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium (PubChem CID 21290420) has the molecular formula C13H27O4P
and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium.
Molecular Properties
| Compound Name | 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium |
| PubChem CID | 21290420 |
| Molecular Formula | C13H27O4P |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium |
| SMILES | CC(C)(C(=O)[O-])C(=O)O.CC[P+](CC)(CC)CC |
| InChI | InChI=1S/C8H20P.C5H8O4/c1-5-9(6-2,7-3)8-4;1-5(2,3(6)7)4(8)9/h5-8H2,1-4H3;1-2H3,(H,6,7)(H,8,9)/q+1;/p-1 |
| InChIKey | KJBOTZGKMFICDJ-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium?
The IUPAC name of 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium (CID 21290420) is 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium.
What is the SMILES notation for 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium?
The canonical SMILES for 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium is CC(C)(C(=O)[O-])C(=O)O.CC[P+](CC)(CC)CC.
What is the InChIKey of 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium?
The InChIKey is KJBOTZGKMFICDJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20P.C5H8O4/c1-5-9(6-2,7-3)8-4;1-5(2,3(6)7)4(8)9/h5-8H2,1-4H3;1-2H3,(H,6,7)(H,8,9)/q+1;/p-1.
What are the key properties of 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium?
3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium has a molecular weight of 278.33 g/mol, XLogP of 1.93, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium is sourced from PubChem (CID 21290420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).