C13H27O4P — CID 21290420
3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium (PubChem CID 21290420) has the molecular formula C13H27O4P and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium.
| Compound Name | 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium |
|---|---|
| PubChem CID | 21290420 |
| Molecular Formula | C13H27O4P |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-3-oxopropanoate;tetraethylphosphanium |
| SMILES | CC(C)(C(=O)[O-])C(=O)O.CC[P+](CC)(CC)CC |
| InChI | InChI=1S/C8H20P.C5H8O4/c1-5-9(6-2,7-3)8-4;1-5(2,3(6)7)4(8)9/h5-8H2,1-4H3;1-2H3,(H,6,7)(H,8,9)/q+1;/p-1 |
| InChIKey | KJBOTZGKMFICDJ-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|