C22H48O7P2+2 — CID 146567573
2-hydroxypropane-1,2,3-tricarboxylic acid;bis(tetraethylphosphanium) (PubChem CID 146567573) has the molecular formula C22H48O7P2+2 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;bis(tetraethylphosphanium).
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;bis(tetraethylphosphanium) |
|---|---|
| PubChem CID | 146567573 |
| Molecular Formula | C22H48O7P2+2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;bis(tetraethylphosphanium) |
| SMILES | CC[P+](CC)(CC)CC.CC[P+](CC)(CC)CC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/2C8H20P.C6H8O7/c2*1-5-9(6-2,7-3)8-4;7-3(8)1-6(13,5(11)12)2-4(9)10/h2*5-8H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/q2*+1; |
| InChIKey | LAKMFVZZQMQYKB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|