C6H9O6- — CID 132502832
(2R,3S)-2,3,4-trihydroxy-2,3-dimethyl-4-oxobutanoate (PubChem CID 132502832) has the molecular formula C6H9O6- and a molecular weight of 177.13 g/mol. Its IUPAC name is (2R,3S)-2,3,4-trihydroxy-2,3-dimethyl-4-oxobutanoate.
| Compound Name | (2R,3S)-2,3,4-trihydroxy-2,3-dimethyl-4-oxobutanoate |
|---|---|
| PubChem CID | 132502832 |
| Molecular Formula | C6H9O6- |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | (2R,3S)-2,3,4-trihydroxy-2,3-dimethyl-4-oxobutanoate |
| SMILES | C[C@](O)(C(=O)[O-])[C@](C)(O)C(=O)O |
| InChI | InChI=1S/C6H10O6/c1-5(11,3(7)8)6(2,12)4(9)10/h11-12H,1-2H3,(H,7,8)(H,9,10)/p-1/t5-,6+ |
| InChIKey | CPLWWXZZFYHPJY-OLQVQODUSA-M |
| XLogP | -2.68 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |