C21H18O5-2 — CID 22289225
3-methylidene-2-(4-methylphenyl)-2-(2-oxo-3-phenylpropyl)butanedioate (PubChem CID 22289225) has the molecular formula C21H18O5-2 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-methylidene-2-(4-methylphenyl)-2-(2-oxo-3-phenylpropyl)butanedioate.
| Compound Name | 3-methylidene-2-(4-methylphenyl)-2-(2-oxo-3-phenylpropyl)butanedioate |
|---|---|
| PubChem CID | 22289225 |
| Molecular Formula | C21H18O5-2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-methylidene-2-(4-methylphenyl)-2-(2-oxo-3-phenylpropyl)butanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)Cc1ccccc1)(C(=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20O5/c1-14-8-10-17(11-9-14)21(20(25)26,15(2)19(23)24)13-18(22)12-16-6-4-3-5-7-16/h3-11H,2,12-13H2,1H3,(H,23,24)(H,25,26)/p-2 |
| InChIKey | DLTDMFKINOFHHS-UHFFFAOYSA-L |
| XLogP | 0.49 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|