C18H18O6-2 — CID 22289736
2-(2-cyclopentyloxy-2-oxoethyl)-3-methylidene-2-phenylbutanedioate (PubChem CID 22289736) has the molecular formula C18H18O6-2 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-(2-cyclopentyloxy-2-oxoethyl)-3-methylidene-2-phenylbutanedioate.
| Compound Name | 2-(2-cyclopentyloxy-2-oxoethyl)-3-methylidene-2-phenylbutanedioate |
|---|---|
| PubChem CID | 22289736 |
| Molecular Formula | C18H18O6-2 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(2-cyclopentyloxy-2-oxoethyl)-3-methylidene-2-phenylbutanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)OC1CCCC1)(C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H20O6/c1-12(16(20)21)18(17(22)23,13-7-3-2-4-8-13)11-15(19)24-14-9-5-6-10-14/h2-4,7-8,14H,1,5-6,9-11H2,(H,20,21)(H,22,23)/p-2 |
| InChIKey | VFMFCYKPCUFSAG-UHFFFAOYSA-L |
| XLogP | -0.14 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|