C14H19NO4S — CID 4983511
cyclohexyl 2-(benzenesulfonamido)acetate (PubChem CID 4983511) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is cyclohexyl 2-(benzenesulfonamido)acetate.
| Compound Name | cyclohexyl 2-(benzenesulfonamido)acetate |
|---|---|
| PubChem CID | 4983511 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | cyclohexyl 2-(benzenesulfonamido)acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)OC1CCCCC1 |
| InChI | InChI=1S/C14H19NO4S/c16-14(19-12-7-3-1-4-8-12)11-15-20(17,18)13-9-5-2-6-10-13/h2,5-6,9-10,12,15H,1,3-4,7-8,11H2 |
| InChIKey | JNYGQEGURQMWMG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |