C13H15NO — CID 13440734
2,2-dimethyl-4-oxo-5-phenylpentanenitrile (PubChem CID 13440734) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-5-phenylpentanenitrile.
| Compound Name | 2,2-dimethyl-4-oxo-5-phenylpentanenitrile |
|---|---|
| PubChem CID | 13440734 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,2-dimethyl-4-oxo-5-phenylpentanenitrile |
| SMILES | CC(C)(C#N)CC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO/c1-13(2,10-14)9-12(15)8-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3 |
| InChIKey | MICRWRDTHMZIJC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |