C17H20N3O4+ — CID 4186806
benzyl-bis[(2,5-dioxopyrrolidin-1-yl)methyl]azanium (PubChem CID 4186806) has the molecular formula C17H20N3O4+ and a molecular weight of 330.36 g/mol. Its IUPAC name is benzyl-bis[(2,5-dioxopyrrolidin-1-yl)methyl]azanium.
| Compound Name | benzyl-bis[(2,5-dioxopyrrolidin-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 4186806 |
| Molecular Formula | C17H20N3O4+ |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | benzyl-bis[(2,5-dioxopyrrolidin-1-yl)methyl]azanium |
| SMILES | O=C1CCC(=O)N1C[NH+](Cc1ccccc1)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C17H19N3O4/c21-14-6-7-15(22)19(14)11-18(10-13-4-2-1-3-5-13)12-20-16(23)8-9-17(20)24/h1-5H,6-12H2/p+1 |
| InChIKey | SFVVUJVBQUWDPQ-UHFFFAOYSA-O |
| XLogP | -0.72 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|