C27H32N3O4+ — CID 11880601
benzyl-bis[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]azanium (PubChem CID 11880601) has the molecular formula C27H32N3O4+ and a molecular weight of 462.57 g/mol. Its IUPAC name is benzyl-bis[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]azanium.
| Compound Name | benzyl-bis[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]azanium |
|---|---|
| PubChem CID | 11880601 |
| Molecular Formula | C27H32N3O4+ |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | benzyl-bis[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]azanium |
| SMILES | O=C1[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C(=O)N1C[NH+](Cc1ccccc1)CN1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C27H31N3O4/c31-24-20-16-6-7-17(10-16)21(20)25(32)29(24)13-28(12-15-4-2-1-3-5-15)14-30-26(33)22-18-8-9-19(11-18)23(22)27(30)34/h1-5,16-23H,6-14H2/p+1/t16-,17+,18-,19+,20-,21+,22-,23+ |
| InChIKey | LVLGVQQQVNFGMK-DJNYIULYSA-O |
| XLogP | 1.05 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|