C27H31N3O4 — CID 11880602
(1R,2R,6S,7S)-4-[[benzyl-[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]amino]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 11880602) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[[benzyl-[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]amino]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-[[benzyl-[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]amino]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11880602 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (1R,2R,6S,7S)-4-[[benzyl-[[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]methyl]amino]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C(=O)N1CN(Cc1ccccc1)CN1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C27H31N3O4/c31-24-20-16-6-7-17(10-16)21(20)25(32)29(24)13-28(12-15-4-2-1-3-5-15)14-30-26(33)22-18-8-9-19(11-18)23(22)27(30)34/h1-5,16-23H,6-14H2/t16-,17+,18-,19+,20-,21+,22-,23+ |
| InChIKey | LVLGVQQQVNFGMK-DJNYIULYSA-N |
| XLogP | 2.47 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|