C11H11NO2 — CID 171688557
1-benzyl-3,3,4,4-tetradeuteriopyrrolidine-2,5-dione (PubChem CID 171688557) has the molecular formula C11H11NO2 and a molecular weight of 193.24 g/mol. Its IUPAC name is 1-benzyl-3,3,4,4-tetradeuteriopyrrolidine-2,5-dione.
| Compound Name | 1-benzyl-3,3,4,4-tetradeuteriopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 171688557 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 1-benzyl-3,3,4,4-tetradeuteriopyrrolidine-2,5-dione |
| SMILES | [2H]C1([2H])C(=O)N(Cc2ccccc2)C(=O)C1([2H])[2H] |
| InChI | InChI=1S/C11H11NO2/c13-10-6-7-11(14)12(10)8-9-4-2-1-3-5-9/h1-5H,6-8H2/i6D2,7D2 |
| InChIKey | IONNJVQITCVNHK-KXGHAPEVSA-N |
| XLogP | 1.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|