C19H19NO — CID 24938872
1,5-dibenzyl-3,4-dihydropyridin-2-one (PubChem CID 24938872) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 1,5-dibenzyl-3,4-dihydropyridin-2-one.
| Compound Name | 1,5-dibenzyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 24938872 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1,5-dibenzyl-3,4-dihydropyridin-2-one |
| SMILES | O=C1CCC(Cc2ccccc2)=CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO/c21-19-12-11-18(13-16-7-3-1-4-8-16)15-20(19)14-17-9-5-2-6-10-17/h1-10,15H,11-14H2 |
| InChIKey | ZIAFYKJAKQECBB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |