C13H14O — CID 143568768
4-benzylcyclohexa-1,3-dien-1-ol (PubChem CID 143568768) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-benzylcyclohexa-1,3-dien-1-ol.
| Compound Name | 4-benzylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 143568768 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4-benzylcyclohexa-1,3-dien-1-ol |
| SMILES | OC1=CC=C(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H14O/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-6,8,14H,7,9-10H2 |
| InChIKey | RJBCFMWQJMLOHN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |