C15H16O — CID 102264743
(2Z,4E)-5-benzylcycloocta-2,4-dien-1-one (PubChem CID 102264743) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (2Z,4E)-5-benzylcycloocta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-5-benzylcycloocta-2,4-dien-1-one |
|---|---|
| PubChem CID | 102264743 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2Z,4E)-5-benzylcycloocta-2,4-dien-1-one |
| SMILES | O=C1/C=C\C=C(\Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C15H16O/c16-15-10-4-8-14(9-5-11-15)12-13-6-2-1-3-7-13/h1-4,6-8,10H,5,9,11-12H2/b10-4-,14-8+ |
| InChIKey | IUDCYGXKLKDHNB-BQIUDISKSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |