About 4-benzyl-3H-dithiole
4-benzyl-3H-dithiole (PubChem CID 172792963) has the molecular formula C10H10S2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-benzyl-3H-dithiole.
Molecular Properties
| Compound Name | 4-benzyl-3H-dithiole |
| PubChem CID | 172792963 |
| Molecular Formula | C10H10S2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 4-benzyl-3H-dithiole |
| SMILES | C1=C(Cc2ccccc2)CSS1 |
| InChI | InChI=1S/C10H10S2/c1-2-4-9(5-3-1)6-10-7-11-12-8-10/h1-5,7H,6,8H2 |
| InChIKey | PVAPRZMKXNRIAH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-3H-dithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3H-dithiole?
The IUPAC name of 4-benzyl-3H-dithiole (CID 172792963) is 4-benzyl-3H-dithiole.
What is the SMILES notation for 4-benzyl-3H-dithiole?
The canonical SMILES for 4-benzyl-3H-dithiole is C1=C(Cc2ccccc2)CSS1.
What is the InChIKey of 4-benzyl-3H-dithiole?
The InChIKey is PVAPRZMKXNRIAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10S2/c1-2-4-9(5-3-1)6-10-7-11-12-8-10/h1-5,7H,6,8H2.
What are the key properties of 4-benzyl-3H-dithiole?
4-benzyl-3H-dithiole has a molecular weight of 194.32 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3H-dithiole is sourced from PubChem (CID 172792963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).