C16H14FeO3 — CID 134899552
carbon monoxide;cyclohexa-1,3-dien-1-ylmethylbenzene;iron (PubChem CID 134899552) has the molecular formula C16H14FeO3 and a molecular weight of 310.13 g/mol. Its IUPAC name is carbon monoxide;cyclohexa-1,3-dien-1-ylmethylbenzene;iron.
| Compound Name | carbon monoxide;cyclohexa-1,3-dien-1-ylmethylbenzene;iron |
|---|---|
| PubChem CID | 134899552 |
| Molecular Formula | C16H14FeO3 |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | carbon monoxide;cyclohexa-1,3-dien-1-ylmethylbenzene;iron |
| SMILES | C1=CCCC(Cc2ccccc2)=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C13H14.3CO.Fe/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;3*1-2;/h1-5,7-9H,6,10-11H2;;;; |
| InChIKey | LJTMRMQYYZHJDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|