C19H21PS — CID 143068600
benzyl-di(cyclohexa-1,3-dien-1-yl)-sulfanylidene-λ5-phosphane (PubChem CID 143068600) has the molecular formula C19H21PS and a molecular weight of 312.42 g/mol. Its IUPAC name is benzyl-di(cyclohexa-1,3-dien-1-yl)-sulfanylidene-λ5-phosphane.
| Compound Name | benzyl-di(cyclohexa-1,3-dien-1-yl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 143068600 |
| Molecular Formula | C19H21PS |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | benzyl-di(cyclohexa-1,3-dien-1-yl)-sulfanylidene-λ5-phosphane |
| SMILES | S=P(Cc1ccccc1)(C1=CC=CCC1)C1=CC=CCC1 |
| InChI | InChI=1S/C19H21PS/c21-20(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17/h1-6,8,10-12,14H,7,9,13,15-16H2 |
| InChIKey | IJNPBLRQCJCJDS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|