C13H14IS+ — CID 143626804
cyclohexa-1,3-dien-1-yl-(iodomethyl)-phenylsulfanium (PubChem CID 143626804) has the molecular formula C13H14IS+ and a molecular weight of 329.23 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl-(iodomethyl)-phenylsulfanium.
| Compound Name | cyclohexa-1,3-dien-1-yl-(iodomethyl)-phenylsulfanium |
|---|---|
| PubChem CID | 143626804 |
| Molecular Formula | C13H14IS+ |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl-(iodomethyl)-phenylsulfanium |
| SMILES | IC[S+](C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C13H14IS/c14-11-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-5,7-9H,6,10-11H2/q+1 |
| InChIKey | UYAMGXZBTRYZGD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|