C19H19S+ — CID 163681831
cyclohepta-1,3-dien-1-yl(diphenyl)sulfanium (PubChem CID 163681831) has the molecular formula C19H19S+ and a molecular weight of 279.43 g/mol. Its IUPAC name is cyclohepta-1,3-dien-1-yl(diphenyl)sulfanium.
| Compound Name | cyclohepta-1,3-dien-1-yl(diphenyl)sulfanium |
|---|---|
| PubChem CID | 163681831 |
| Molecular Formula | C19H19S+ |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | cyclohepta-1,3-dien-1-yl(diphenyl)sulfanium |
| SMILES | C1=CCCCC([S+](c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C19H19S/c1-2-6-12-17(11-5-1)20(18-13-7-3-8-14-18)19-15-9-4-10-16-19/h1,3-5,7-11,13-16H,2,6,12H2/q+1 |
| InChIKey | JLLWEVZBWFKIDY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|