About dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane
dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane (PubChem CID 90322017) has the molecular formula C12H12Cl2Si
and a molecular weight of 255.22 g/mol. Its IUPAC name is dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane.
Molecular Properties
| Compound Name | dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane |
| PubChem CID | 90322017 |
| Molecular Formula | C12H12Cl2Si |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane |
| SMILES | Cl[Si](Cl)(C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C12H12Cl2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-5,7-9H,6,10H2 |
| InChIKey | KRJKGPQWEGEGRR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane?
The IUPAC name of dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane (CID 90322017) is dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane.
What is the SMILES notation for dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane?
The canonical SMILES for dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane is Cl[Si](Cl)(C1=CC=CCC1)c1ccccc1.
What is the InChIKey of dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane?
The InChIKey is KRJKGPQWEGEGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-5,7-9H,6,10H2.
What are the key properties of dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane?
dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane has a molecular weight of 255.22 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-cyclohexa-1,3-dien-1-yl-phenylsilane is sourced from PubChem (CID 90322017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).