C16H23I — CID 142152565
2-cyclohexa-1,3-dien-1-ylethylbenzene;ethane;hydroiodide (PubChem CID 142152565) has the molecular formula C16H23I and a molecular weight of 342.26 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylethylbenzene;ethane;hydroiodide.
| Compound Name | 2-cyclohexa-1,3-dien-1-ylethylbenzene;ethane;hydroiodide |
|---|---|
| PubChem CID | 142152565 |
| Molecular Formula | C16H23I |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylethylbenzene;ethane;hydroiodide |
| SMILES | C1=CCCC(CCc2ccccc2)=C1.CC.I |
| InChI | InChI=1S/C14H16.C2H6.HI/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2;/h1-5,7-9H,6,10-12H2;1-2H3;1H |
| InChIKey | LXUFFABSFLEPGH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|