C23H30 — CID 142323163
1-(3-cyclohexylprop-2-ynyl)cyclohexa-1,3-diene;ethylbenzene (PubChem CID 142323163) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-(3-cyclohexylprop-2-ynyl)cyclohexa-1,3-diene;ethylbenzene.
| Compound Name | 1-(3-cyclohexylprop-2-ynyl)cyclohexa-1,3-diene;ethylbenzene |
|---|---|
| PubChem CID | 142323163 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-(3-cyclohexylprop-2-ynyl)cyclohexa-1,3-diene;ethylbenzene |
| SMILES | C(#CC1CCCCC1)CC1=CC=CCC1.CCc1ccccc1 |
| InChI | InChI=1S/C15H20.C8H10/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;1-2-8-6-4-3-5-7-8/h1,3,8,15H,2,4-6,9-12H2;3-7H,2H2,1H3 |
| InChIKey | ZIMUPXDFZAJWQN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|