About tert-butylperoxycyclohexane;ethylbenzene
tert-butylperoxycyclohexane;ethylbenzene (PubChem CID 175601662) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is tert-butylperoxycyclohexane;ethylbenzene.
Molecular Properties
| Compound Name | tert-butylperoxycyclohexane;ethylbenzene |
| PubChem CID | 175601662 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | tert-butylperoxycyclohexane;ethylbenzene |
| SMILES | CC(C)(C)OOC1CCCCC1.CCc1ccccc1 |
| InChI | InChI=1S/C10H20O2.C8H10/c1-10(2,3)12-11-9-7-5-4-6-8-9;1-2-8-6-4-3-5-7-8/h9H,4-8H2,1-3H3;3-7H,2H2,1H3 |
| InChIKey | QRCQSUMWQYOGEE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butylperoxycyclohexane;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylperoxycyclohexane;ethylbenzene?
The IUPAC name of tert-butylperoxycyclohexane;ethylbenzene (CID 175601662) is tert-butylperoxycyclohexane;ethylbenzene.
What is the SMILES notation for tert-butylperoxycyclohexane;ethylbenzene?
The canonical SMILES for tert-butylperoxycyclohexane;ethylbenzene is CC(C)(C)OOC1CCCCC1.CCc1ccccc1.
What is the InChIKey of tert-butylperoxycyclohexane;ethylbenzene?
The InChIKey is QRCQSUMWQYOGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C8H10/c1-10(2,3)12-11-9-7-5-4-6-8-9;1-2-8-6-4-3-5-7-8/h9H,4-8H2,1-3H3;3-7H,2H2,1H3.
What are the key properties of tert-butylperoxycyclohexane;ethylbenzene?
tert-butylperoxycyclohexane;ethylbenzene has a molecular weight of 278.44 g/mol, XLogP of 5.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylperoxycyclohexane;ethylbenzene is sourced from PubChem (CID 175601662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).