C13H22NOY- — CID 172605218
cyclohexa-1,3-dien-1-ylmethylazanide;cyclohexanol;yttrium (PubChem CID 172605218) has the molecular formula C13H22NOY- and a molecular weight of 297.23 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-ylmethylazanide;cyclohexanol;yttrium.
| Compound Name | cyclohexa-1,3-dien-1-ylmethylazanide;cyclohexanol;yttrium |
|---|---|
| PubChem CID | 172605218 |
| Molecular Formula | C13H22NOY- |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | cyclohexa-1,3-dien-1-ylmethylazanide;cyclohexanol;yttrium |
| SMILES | OC1CCCCC1.[NH-]CC1=CC=CCC1.[Y] |
| InChI | InChI=1S/C7H10N.C6H12O.Y/c8-6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6;/h1-2,4,8H,3,5-6H2;6-7H,1-5H2;/q-1;; |
| InChIKey | VMHRSOCWVIARKX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |