C24H36O3 — CID 90182804
(4R)-1-cyclohexa-1,3-dien-1-yl-3-cyclohex-3-en-1-yl-4-cyclooctyloxy-4-hydroxybutan-2-one (PubChem CID 90182804) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (4R)-1-cyclohexa-1,3-dien-1-yl-3-cyclohex-3-en-1-yl-4-cyclooctyloxy-4-hydroxybutan-2-one.
| Compound Name | (4R)-1-cyclohexa-1,3-dien-1-yl-3-cyclohex-3-en-1-yl-4-cyclooctyloxy-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 90182804 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (4R)-1-cyclohexa-1,3-dien-1-yl-3-cyclohex-3-en-1-yl-4-cyclooctyloxy-4-hydroxybutan-2-one |
| SMILES | O=C(CC1=CC=CCC1)C(C1CC=CCC1)[C@H](O)OC1CCCCCCC1 |
| InChI | InChI=1S/C24H36O3/c25-22(18-19-12-6-4-7-13-19)23(20-14-8-5-9-15-20)24(26)27-21-16-10-2-1-3-11-17-21/h4-6,8,12,20-21,23-24,26H,1-3,7,9-11,13-18H2/t20?,23?,24-/m1/s1 |
| InChIKey | XBVSPFKSJWGUDR-VZYOYLOZSA-N |
| XLogP | 5.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|