C18H30O2 — CID 89335059
(5S)-3-[(1S)-cyclohex-3-en-1-yl]-5-cyclohexyloxyhex-1-en-2-ol (PubChem CID 89335059) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (5S)-3-[(1S)-cyclohex-3-en-1-yl]-5-cyclohexyloxyhex-1-en-2-ol.
| Compound Name | (5S)-3-[(1S)-cyclohex-3-en-1-yl]-5-cyclohexyloxyhex-1-en-2-ol |
|---|---|
| PubChem CID | 89335059 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (5S)-3-[(1S)-cyclohex-3-en-1-yl]-5-cyclohexyloxyhex-1-en-2-ol |
| SMILES | C=C(O)C(C[C@H](C)OC1CCCCC1)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C18H30O2/c1-14(20-17-11-7-4-8-12-17)13-18(15(2)19)16-9-5-3-6-10-16/h3,5,14,16-19H,2,4,6-13H2,1H3/t14-,16+,18?/m0/s1 |
| InChIKey | OZWZNPQFTHQEQR-QJZXMCBYSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|