About cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one
cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one (PubChem CID 158505336) has the molecular formula C20H36O4
and a molecular weight of 340.50 g/mol. Its IUPAC name is cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one.
Molecular Properties
| Compound Name | cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one |
| PubChem CID | 158505336 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one |
| SMILES | C1=CCCCC1.CC(=O)C(C)O.CC(=O)C(C)OC1CCCCC1 |
| InChI | InChI=1S/C10H18O2.C6H10.C4H8O2/c1-8(11)9(2)12-10-6-4-3-5-7-10;1-2-4-6-5-3-1;1-3(5)4(2)6/h9-10H,3-7H2,1-2H3;1-2H,3-6H2;3,5H,1-2H3 |
| InChIKey | HKKADPNFMTZVFW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one?
The IUPAC name of cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one (CID 158505336) is cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one.
What is the SMILES notation for cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one?
The canonical SMILES for cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one is C1=CCCCC1.CC(=O)C(C)O.CC(=O)C(C)OC1CCCCC1.
What is the InChIKey of cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one?
The InChIKey is HKKADPNFMTZVFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C6H10.C4H8O2/c1-8(11)9(2)12-10-6-4-3-5-7-10;1-2-4-6-5-3-1;1-3(5)4(2)6/h9-10H,3-7H2,1-2H3;1-2H,3-6H2;3,5H,1-2H3.
What are the key properties of cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one?
cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one has a molecular weight of 340.50 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene;3-cyclohexyloxybutan-2-one;3-hydroxybutan-2-one is sourced from PubChem (CID 158505336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).