About cyclohexene;cyclohexyloxycyclohexane
cyclohexene;cyclohexyloxycyclohexane (PubChem CID 174935806) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is cyclohexene;cyclohexyloxycyclohexane.
Molecular Properties
| Compound Name | cyclohexene;cyclohexyloxycyclohexane |
| PubChem CID | 174935806 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | cyclohexene;cyclohexyloxycyclohexane |
| SMILES | C1=CCCCC1.C1CCC(OC2CCCCC2)CC1 |
| InChI | InChI=1S/C12H22O.C6H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h11-12H,1-10H2;1-2H,3-6H2 |
| InChIKey | GMSRYOIGWCKVSD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene;cyclohexyloxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene;cyclohexyloxycyclohexane?
The IUPAC name of cyclohexene;cyclohexyloxycyclohexane (CID 174935806) is cyclohexene;cyclohexyloxycyclohexane.
What is the SMILES notation for cyclohexene;cyclohexyloxycyclohexane?
The canonical SMILES for cyclohexene;cyclohexyloxycyclohexane is C1=CCCCC1.C1CCC(OC2CCCCC2)CC1.
What is the InChIKey of cyclohexene;cyclohexyloxycyclohexane?
The InChIKey is GMSRYOIGWCKVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C6H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h11-12H,1-10H2;1-2H,3-6H2.
What are the key properties of cyclohexene;cyclohexyloxycyclohexane?
cyclohexene;cyclohexyloxycyclohexane has a molecular weight of 264.45 g/mol, XLogP of 5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene;cyclohexyloxycyclohexane is sourced from PubChem (CID 174935806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).