About cyclododecene;cyclohexylcyclohexane
cyclododecene;cyclohexylcyclohexane (PubChem CID 173310836) has the molecular formula C24H44
and a molecular weight of 332.62 g/mol. Its IUPAC name is cyclododecene;cyclohexylcyclohexane.
Molecular Properties
| Compound Name | cyclododecene;cyclohexylcyclohexane |
| PubChem CID | 173310836 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | cyclododecene;cyclohexylcyclohexane |
| SMILES | C1=CCCCCCCCCCC1.C1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/2C12H22/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-8-10-12-11-9-7-5-3-1/h11-12H,1-10H2;1-2H,3-12H2 |
| InChIKey | ZPFFYYHMLXNDJK-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclododecene;cyclohexylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclododecene;cyclohexylcyclohexane?
The IUPAC name of cyclododecene;cyclohexylcyclohexane (CID 173310836) is cyclododecene;cyclohexylcyclohexane.
What is the SMILES notation for cyclododecene;cyclohexylcyclohexane?
The canonical SMILES for cyclododecene;cyclohexylcyclohexane is C1=CCCCCCCCCCC1.C1CCC(C2CCCCC2)CC1.
What is the InChIKey of cyclododecene;cyclohexylcyclohexane?
The InChIKey is ZPFFYYHMLXNDJK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H22/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-8-10-12-11-9-7-5-3-1/h11-12H,1-10H2;1-2H,3-12H2.
What are the key properties of cyclododecene;cyclohexylcyclohexane?
cyclododecene;cyclohexylcyclohexane has a molecular weight of 332.62 g/mol, XLogP of 8.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclododecene;cyclohexylcyclohexane is sourced from PubChem (CID 173310836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).