About cyclobutyloxycyclobutane;hydrofluoride
cyclobutyloxycyclobutane;hydrofluoride (PubChem CID 174842144) has the molecular formula C8H15FO
and a molecular weight of 146.21 g/mol. Its IUPAC name is cyclobutyloxycyclobutane;hydrofluoride.
Molecular Properties
| Compound Name | cyclobutyloxycyclobutane;hydrofluoride |
| PubChem CID | 174842144 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | cyclobutyloxycyclobutane;hydrofluoride |
| SMILES | C1CC(OC2CCC2)C1.F |
| InChI | InChI=1S/C8H14O.FH/c1-3-7(4-1)9-8-5-2-6-8;/h7-8H,1-6H2;1H |
| InChIKey | FTEJSTBVMOCDMP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclobutyloxycyclobutane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyloxycyclobutane;hydrofluoride?
The IUPAC name of cyclobutyloxycyclobutane;hydrofluoride (CID 174842144) is cyclobutyloxycyclobutane;hydrofluoride.
What is the SMILES notation for cyclobutyloxycyclobutane;hydrofluoride?
The canonical SMILES for cyclobutyloxycyclobutane;hydrofluoride is C1CC(OC2CCC2)C1.F.
What is the InChIKey of cyclobutyloxycyclobutane;hydrofluoride?
The InChIKey is FTEJSTBVMOCDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.FH/c1-3-7(4-1)9-8-5-2-6-8;/h7-8H,1-6H2;1H.
What are the key properties of cyclobutyloxycyclobutane;hydrofluoride?
cyclobutyloxycyclobutane;hydrofluoride has a molecular weight of 146.21 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyloxycyclobutane;hydrofluoride is sourced from PubChem (CID 174842144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).