C36H28O2P2S — CID 142301618
2-[cyclohexa-1,3-dien-1-yl(phenyl)phosphoryl]-8-diphenylphosphoryldibenzothiophene (PubChem CID 142301618) has the molecular formula C36H28O2P2S and a molecular weight of 586.63 g/mol. Its IUPAC name is 2-[cyclohexa-1,3-dien-1-yl(phenyl)phosphoryl]-8-diphenylphosphoryldibenzothiophene.
| Compound Name | 2-[cyclohexa-1,3-dien-1-yl(phenyl)phosphoryl]-8-diphenylphosphoryldibenzothiophene |
|---|---|
| PubChem CID | 142301618 |
| Molecular Formula | C36H28O2P2S |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | 2-[cyclohexa-1,3-dien-1-yl(phenyl)phosphoryl]-8-diphenylphosphoryldibenzothiophene |
| SMILES | O=P(C1=CC=CCC1)(c1ccccc1)c1ccc2sc3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C36H28O2P2S/c37-39(27-13-5-1-6-14-27,28-15-7-2-8-16-28)31-21-23-35-33(25-31)34-26-32(22-24-36(34)41-35)40(38,29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-11,13-19,21-26H,12,20H2 |
| InChIKey | GRADGEXHAXSWJB-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|