C60H40N2O2P2S — CID 156560742
4-[3-[3-[(8-diphenylphosphoryldibenzothiophen-2-yl)-phenylphosphoryl]phenyl]phenyl]-7-phenyl-1,10-phenanthroline (PubChem CID 156560742) has the molecular formula C60H40N2O2P2S and a molecular weight of 915.01 g/mol. Its IUPAC name is 4-[3-[3-[(8-diphenylphosphoryldibenzothiophen-2-yl)-phenylphosphoryl]phenyl]phenyl]-7-phenyl-1,10-phenanthroline.
| Compound Name | 4-[3-[3-[(8-diphenylphosphoryldibenzothiophen-2-yl)-phenylphosphoryl]phenyl]phenyl]-7-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 156560742 |
| Molecular Formula | C60H40N2O2P2S |
| Molecular Weight | 915.01 g/mol |
| Exact Mass | 914.23 |
| IUPAC Name | 4-[3-[3-[(8-diphenylphosphoryldibenzothiophen-2-yl)-phenylphosphoryl]phenyl]phenyl]-7-phenyl-1,10-phenanthroline |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc2sc3ccc(P(=O)(c4ccccc4)c4cccc(-c5cccc(-c6ccnc7c6ccc6c(-c8ccccc8)ccnc67)c5)c4)cc3c2c1 |
| InChI | InChI=1S/C60H40N2O2P2S/c63-65(45-20-7-2-8-21-45,46-22-9-3-10-23-46)49-27-31-57-55(39-49)56-40-50(28-32-58(56)67-57)66(64,47-24-11-4-12-25-47)48-26-14-18-43(38-48)42-17-13-19-44(37-42)52-34-36-62-60-54(52)30-29-53-51(33-35-61-59(53)60)41-15-5-1-6-16-41/h1-40H |
| InChIKey | TWKVYXTUSKYBAI-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.01 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|