C36H29NO2P2 — CID 145178902
3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphoryl]-6-diphenylphosphoryl-9H-carbazole (PubChem CID 145178902) has the molecular formula C36H29NO2P2 and a molecular weight of 569.58 g/mol. Its IUPAC name is 3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphoryl]-6-diphenylphosphoryl-9H-carbazole.
| Compound Name | 3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphoryl]-6-diphenylphosphoryl-9H-carbazole |
|---|---|
| PubChem CID | 145178902 |
| Molecular Formula | C36H29NO2P2 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphoryl]-6-diphenylphosphoryl-9H-carbazole |
| SMILES | O=P(C1=CCCC=C1)(c1ccccc1)c1ccc2[nH]c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C36H29NO2P2/c38-40(27-13-5-1-6-14-27,28-15-7-2-8-16-28)31-21-23-35-33(25-31)34-26-32(22-24-36(34)37-35)41(39,29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-3,5-11,13-26,37H,4,12H2 |
| InChIKey | ATPUJCAKLYWNIP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|