C21H16ClNO — CID 142993457
6-chloro-3-cyclohexa-1,5-dien-1-yl-4-phenyl-1H-quinolin-2-one (PubChem CID 142993457) has the molecular formula C21H16ClNO and a molecular weight of 333.82 g/mol. Its IUPAC name is 6-chloro-3-cyclohexa-1,5-dien-1-yl-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-cyclohexa-1,5-dien-1-yl-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142993457 |
| Molecular Formula | C21H16ClNO |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 6-chloro-3-cyclohexa-1,5-dien-1-yl-4-phenyl-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2c(-c2ccccc2)c1C1=CCCC=C1 |
| InChI | InChI=1S/C21H16ClNO/c22-16-11-12-18-17(13-16)19(14-7-3-1-4-8-14)20(21(24)23-18)15-9-5-2-6-10-15/h1,3-5,7-13H,2,6H2,(H,23,24) |
| InChIKey | ZGHDKKICJJMYSC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |