C31H23ClN4OS — CID 136829380
(3R)-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N,3-diphenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 136829380) has the molecular formula C31H23ClN4OS and a molecular weight of 535.07 g/mol. Its IUPAC name is (3R)-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N,3-diphenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3R)-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N,3-diphenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 136829380 |
| Molecular Formula | C31H23ClN4OS |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | (3R)-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N,3-diphenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | O=c1[nH]c2ccc(Cl)cc2c(-c2ccccc2)c1C1=NN(C(=S)Nc2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C31H23ClN4OS/c32-22-16-17-25-24(18-22)28(21-12-6-2-7-13-21)29(30(37)34-25)26-19-27(20-10-4-1-5-11-20)36(35-26)31(38)33-23-14-8-3-9-15-23/h1-18,27H,19H2,(H,33,38)(H,34,37)/t27-/m1/s1 |
| InChIKey | HIILQRZZGDVTFS-HHHXNRCGSA-N |
| XLogP | 7.40 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|