C32H24Cl2N4OS — CID 3962252
N-benzyl-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(2-chlorophenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 3962252) has the molecular formula C32H24Cl2N4OS and a molecular weight of 583.54 g/mol. Its IUPAC name is N-benzyl-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(2-chlorophenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-benzyl-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(2-chlorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 3962252 |
| Molecular Formula | C32H24Cl2N4OS |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | N-benzyl-5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(2-chlorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | O=c1[nH]c2ccc(Cl)cc2c(-c2ccccc2)c1C1=NN(C(=S)NCc2ccccc2)C(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C32H24Cl2N4OS/c33-22-15-16-26-24(17-22)29(21-11-5-2-6-12-21)30(31(39)36-26)27-18-28(23-13-7-8-14-25(23)34)38(37-27)32(40)35-19-20-9-3-1-4-10-20/h1-17,28H,18-19H2,(H,35,40)(H,36,39) |
| InChIKey | SAOSESSJCJFOPF-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|